Class information for: |
Basic class information |
| ID | Publications | Average number of references |
Avg. shr. active ref. in WoS |
|---|---|---|---|
| 3197 | 1571 | 19.8 | 58% |
Classes in level above (level 3) |
| ID, lev. above |
Publications | Label for level above |
|---|---|---|
| 282 | 38172 | FERROELECTRICS//CRYSTAL AND LIGAND FIELD THEORY//THERMOCHEM |
Classes in level below (level 1) |
| ID, lev. below |
Publications | Label for level below |
|---|---|---|
| 5321 | 1571 | CSHSO4//SUPERPROTONIC CONDUCTOR//RB3HSEO42 |
Terms with highest relevance score |
| Rank | Term | Type of term | Relevance score (tfidf) |
Class's shr. of term's tot. occurrences |
Shr. of publ. in class containing term |
Num. of publ. in class |
|---|---|---|---|---|---|---|
| 1 | CSHSO4 | Author keyword | 79 | 94% | 2% | 29 |
| 2 | SUPERPROTONIC CONDUCTOR | Author keyword | 42 | 94% | 1% | 15 |
| 3 | RB3HSEO42 | Author keyword | 30 | 100% | 1% | 12 |
| 4 | INORGANIC SOLID ACID | Author keyword | 20 | 100% | 1% | 9 |
| 5 | NH43HSO42 | Author keyword | 20 | 100% | 1% | 9 |
| 6 | K3HSO42 | Author keyword | 18 | 83% | 1% | 10 |
| 7 | TIN PYROPHOSPHATE | Author keyword | 18 | 83% | 1% | 10 |
| 8 | INTERMEDIATE TEMPERATURE FUEL CELLS | Author keyword | 16 | 60% | 1% | 18 |
| 9 | SUPERPROTONIC PHASE TRANSITION | Author keyword | 15 | 82% | 1% | 9 |
| 10 | SUPERIONIC PHASE TRANSITION | Author keyword | 15 | 77% | 1% | 10 |
Web of Science journal categories |
Author Key Words |
| Rank | Web of Science journal category | Relevance score (tfidf) |
Class's shr. of term's tot. occurrences |
Shr. of publ. in class containing term |
Num. of publ. in class |
LCSH search | Wikipedia search |
|---|---|---|---|---|---|---|---|
| 1 | CSHSO4 | 79 | 94% | 2% | 29 | Search CSHSO4 | Search CSHSO4 |
| 2 | SUPERPROTONIC CONDUCTOR | 42 | 94% | 1% | 15 | Search SUPERPROTONIC+CONDUCTOR | Search SUPERPROTONIC+CONDUCTOR |
| 3 | RB3HSEO42 | 30 | 100% | 1% | 12 | Search RB3HSEO42 | Search RB3HSEO42 |
| 4 | INORGANIC SOLID ACID | 20 | 100% | 1% | 9 | Search INORGANIC+SOLID+ACID | Search INORGANIC+SOLID+ACID |
| 5 | NH43HSO42 | 20 | 100% | 1% | 9 | Search NH43HSO42 | Search NH43HSO42 |
| 6 | K3HSO42 | 18 | 83% | 1% | 10 | Search K3HSO42 | Search K3HSO42 |
| 7 | TIN PYROPHOSPHATE | 18 | 83% | 1% | 10 | Search TIN+PYROPHOSPHATE | Search TIN+PYROPHOSPHATE |
| 8 | INTERMEDIATE TEMPERATURE FUEL CELLS | 16 | 60% | 1% | 18 | Search INTERMEDIATE+TEMPERATURE+FUEL+CELLS | Search INTERMEDIATE+TEMPERATURE+FUEL+CELLS |
| 9 | SUPERPROTONIC PHASE TRANSITION | 15 | 82% | 1% | 9 | Search SUPERPROTONIC+PHASE+TRANSITION | Search SUPERPROTONIC+PHASE+TRANSITION |
| 10 | SUPERIONIC PHASE TRANSITION | 15 | 77% | 1% | 10 | Search SUPERIONIC+PHASE+TRANSITION | Search SUPERIONIC+PHASE+TRANSITION |
Key Words Plus |
| Rank | Web of Science journal category | Relevance score (tfidf) |
Class's shr. of term's tot. occurrences |
Shr. of publ. in class containing term |
Num. of publ. in class |
|---|---|---|---|---|---|
| 1 | CSHSO4 | 260 | 88% | 8% | 121 |
| 2 | CSHSEO4 | 198 | 91% | 5% | 82 |
| 3 | RB3HSEO42 | 140 | 94% | 3% | 49 |
| 4 | NH43HSO42 | 123 | 89% | 4% | 56 |
| 5 | NH43HSEO42 | 118 | 90% | 3% | 52 |
| 6 | TRIAMMONIUM HYDROGEN DISULFATE | 104 | 90% | 3% | 45 |
| 7 | K3HSO42 | 89 | 92% | 2% | 35 |
| 8 | CSDSO4 | 69 | 91% | 2% | 29 |
| 9 | K3HSEO42 | 61 | 95% | 1% | 20 |
| 10 | CSH2PO4 | 56 | 57% | 4% | 67 |
Journals |
Reviews |
| Title | Publ. year | Cit. | Active references | % act. ref. to same field |
|---|---|---|---|---|
| Solid acids as electrolyte materials for proton exchange membrane (PEM) electrolysis: Review | 2012 | 30 | 116 | 55% |
| Intermediate temperature proton-conducting membrane electrolytes for fuel cells | 2014 | 9 | 85 | 46% |
| A review on phosphate based, solid state, protonic conductors for intermediate temperature fuel cells | 2011 | 34 | 97 | 68% |
| Crystals with disordered hydrogen-bond networks and superprotonic conductivity. Review | 2003 | 43 | 86 | 95% |
| Proton exchange membranes for fuel cells operated at medium temperatures: Materials and experimental techniques | 2011 | 51 | 232 | 33% |
| Controlling the proton transport properties of solid acids via structural and microstructural modification | 2011 | 10 | 69 | 83% |
| Development of Novel Proton Conductors Consisting of Solid Acid/pyrophosphate Composite for Intermediate-temperature Fuel Cells | 2010 | 6 | 31 | 81% |
| Development and Application of SnP2O7-based Proton Conductors to Intermediate-temperature Fuel Cells | 2010 | 13 | 47 | 45% |
| Structural, vibrational and dielectric properties of new potassium hydrogen sulfate arsenate: K-4(SO4)(HSO4)(2)(H3AsO4) | 2007 | 7 | 22 | 82% |
| Synthesis, structure determination and calorimetric study of new caesium hydrogen selenate arsenate Cs-4(SeO4)(HSeO4)(2)(H3AsO4) | 2009 | 5 | 21 | 71% |
Address terms |
| Rank | Address term | Relevance score (tfidf) |
Class's shr. of term's tot. occurrences |
Shr. of publ. in class containing term |
Num. of publ. in class |
|---|---|---|---|---|---|
| 1 | ETAT SOLIDE | 5 | 14% | 2.0% | 31 |
| 2 | ANHUI PROV DE AT MONITORING POLLUT E | 3 | 100% | 0.2% | 3 |
| 3 | ETAT SOLIDE LES | 2 | 67% | 0.1% | 2 |
| 4 | GRP DIELECT | 1 | 50% | 0.1% | 1 |
| 5 | GRP NEUTRON SCATTERING ULTRALOW TEMP | 1 | 50% | 0.1% | 1 |
| 6 | JCNS OUTSTN FRM 2 | 1 | 50% | 0.1% | 1 |
| 7 | MAT SCI 138 78 | 1 | 50% | 0.1% | 1 |
| 8 | MINERAL PETROG MUSEUM | 1 | 50% | 0.1% | 1 |
| 9 | NIZHNY TAGIL | 1 | 50% | 0.1% | 1 |
| 10 | KECK S | 1 | 29% | 0.1% | 2 |
Related classes at same level (level 2) |
| Rank | Relatedness score | Related classes |
|---|---|---|
| 1 | 0.0000029868 | DOUBLE BETAINE//N METHYLPIPERIDINE BETAINE//N METHYLMORPHOLINE BETAINE |
| 2 | 0.0000029395 | FERROELECTRICS//QUANTUM PARAELECTRICS//FERROELECTRICS LETTERS SECTION |
| 3 | 0.0000015803 | SUPERIONIC CONDUCTOR//SILVER SELENIDE//AG2SE |
| 4 | 0.0000009923 | INORGAN MAT PROGRAM//NEW MINERAL//TOLBACHIK VOLCANO |
| 5 | 0.0000009236 | LINEAR DICHROIC EFFECTS//PROTON SPONGES//H D ISOTOPIC EFFECTS |
| 6 | 0.0000008426 | NEGATIVE THERMAL EXPANSION//ZRW2O8//ANTIPEROVSKITE |
| 7 | 0.0000008125 | REORIENTATIONAL MOTIONS//KAZAN BRANCH//PHASE TRANSIT TEAM |
| 8 | 0.0000007806 | ZINC PHOSPHITE//OPEN FRAMEWORK//CHIM MAT |
| 9 | 0.0000007701 | DIRECT METHANOL FUEL CELL//PEMFC//OXYGEN REDUCTION REACTION |
| 10 | 0.0000007350 | METAL PHOSPHONATES//ZIRCONIUM PHOSPHATE//ALPHA ZIRCONIUM PHOSPHATE |